C11H16N2O — CID 103453597
1-(1-butan-2-ylpyrazol-3-yl)but-3-en-2-one (PubChem CID 103453597) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)but-3-en-2-one.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 103453597 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccn(C(C)CC)n1 |
| InChI | InChI=1S/C11H16N2O/c1-4-9(3)13-7-6-10(12-13)8-11(14)5-2/h5-7,9H,2,4,8H2,1,3H3 |
| InChIKey | IWCMJUSQTZBOQB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|