C28H28F2N4O2 — CID 10345459
2-(2,5-difluorophenyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-prop-2-enylanilino]acetic acid (PubChem CID 10345459) has the molecular formula C28H28F2N4O2 and a molecular weight of 490.55 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-prop-2-enylanilino]acetic acid.
| Compound Name | 2-(2,5-difluorophenyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-prop-2-enylanilino]acetic acid |
|---|---|
| PubChem CID | 10345459 |
| Molecular Formula | C28H28F2N4O2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-prop-2-enylanilino]acetic acid |
| SMILES | C=CCN(c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1)C(C(=O)O)c1cc(F)ccc1F |
| InChI | InChI=1S/C28H28F2N4O2/c1-5-13-33(26(28(35)36)22-15-20(29)9-12-23(22)30)21-10-7-19(8-11-21)16-34-24(6-2)32-25-17(3)14-18(4)31-27(25)34/h5,7-12,14-15,26H,1,6,13,16H2,2-4H3,(H,35,36) |
| InChIKey | HTEDINUDVZQVRJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|