C12H22O3 — CID 103454715
1-(5-oxaspiro[3.5]nonan-8-yl)butane-1,2-diol (PubChem CID 103454715) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-(5-oxaspiro[3.5]nonan-8-yl)butane-1,2-diol.
| Compound Name | 1-(5-oxaspiro[3.5]nonan-8-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 103454715 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-(5-oxaspiro[3.5]nonan-8-yl)butane-1,2-diol |
| SMILES | CCC(O)C(O)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C12H22O3/c1-2-10(13)11(14)9-4-7-15-12(8-9)5-3-6-12/h9-11,13-14H,2-8H2,1H3 |
| InChIKey | XRRAWHDOPYXPSJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |