C17H24F3NO8S2 — CID 10345497
2-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1,3-thiazol-3-ium;trifluoromethanesulfonate (PubChem CID 10345497) has the molecular formula C17H24F3NO8S2 and a molecular weight of 491.51 g/mol. Its IUPAC name is 2-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1,3-thiazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 2-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1,3-thiazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10345497 |
| Molecular Formula | C17H24F3NO8S2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1,3-thiazol-3-ium;trifluoromethanesulfonate |
| SMILES | C[n+]1ccsc1[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H24NO5S.CHF3O3S/c1-15(2)18-8-9(20-15)10-11-12(22-16(3,4)21-11)13(19-10)14-17(5)6-7-23-14;2-1(3,4)8(5,6)7/h6-7,9-13H,8H2,1-5H3;(H,5,6,7)/q+1;/p-1/t9-,10-,11+,12+,13-;/m1./s1 |
| InChIKey | COHOUDAMAQTHJF-RLBMKGCXSA-M |
| XLogP | 1.74 |
| TPSA | 107.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|