C14H26O2 — CID 103456180
1-(3-ethylcyclohexyl)-2-hydroxy-3,3-dimethylbutan-1-one (PubChem CID 103456180) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-2-hydroxy-3,3-dimethylbutan-1-one.
| Compound Name | 1-(3-ethylcyclohexyl)-2-hydroxy-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 103456180 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-2-hydroxy-3,3-dimethylbutan-1-one |
| SMILES | CCC1CCCC(C(=O)C(O)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H26O2/c1-5-10-7-6-8-11(9-10)12(15)13(16)14(2,3)4/h10-11,13,16H,5-9H2,1-4H3 |
| InChIKey | OQSLFPJIOKWUFO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |