C12H19NO2 — CID 103457204
3,3-dimethyl-1-(4-methyl-3-pyridinyl)butane-1,2-diol (PubChem CID 103457204) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methyl-3-pyridinyl)butane-1,2-diol.
| Compound Name | 3,3-dimethyl-1-(4-methyl-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 103457204 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3,3-dimethyl-1-(4-methyl-3-pyridinyl)butane-1,2-diol |
| SMILES | Cc1ccncc1C(O)C(O)C(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-8-5-6-13-7-9(8)10(14)11(15)12(2,3)4/h5-7,10-11,14-15H,1-4H3 |
| InChIKey | LZMJOPDSLSROTF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |