C16H24O3 — CID 103459031
1-cyclohexyl-2-(2-methoxy-5-methylphenyl)ethane-1,2-diol (PubChem CID 103459031) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2-methoxy-5-methylphenyl)ethane-1,2-diol.
| Compound Name | 1-cyclohexyl-2-(2-methoxy-5-methylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 103459031 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-cyclohexyl-2-(2-methoxy-5-methylphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(C)cc1C(O)C(O)C1CCCCC1 |
| InChI | InChI=1S/C16H24O3/c1-11-8-9-14(19-2)13(10-11)16(18)15(17)12-6-4-3-5-7-12/h8-10,12,15-18H,3-7H2,1-2H3 |
| InChIKey | TVDGPGGTPZDFRO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |