C15H14BrFO2 — CID 103459440
3-(2-bromo-3-fluorophenyl)-1-phenylpropane-1,2-diol (PubChem CID 103459440) has the molecular formula C15H14BrFO2 and a molecular weight of 325.18 g/mol. Its IUPAC name is 3-(2-bromo-3-fluorophenyl)-1-phenylpropane-1,2-diol.
| Compound Name | 3-(2-bromo-3-fluorophenyl)-1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 103459440 |
| Molecular Formula | C15H14BrFO2 |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-(2-bromo-3-fluorophenyl)-1-phenylpropane-1,2-diol |
| SMILES | OC(Cc1cccc(F)c1Br)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H14BrFO2/c16-14-11(7-4-8-12(14)17)9-13(18)15(19)10-5-2-1-3-6-10/h1-8,13,15,18-19H,9H2 |
| InChIKey | VIASDVSNUBXUNS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |