C29H44O7 — CID 10346026
[(1S,3R,5R,6aS,7S,8S,9S)-1-acetyloxy-9-butoxy-5-methoxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] acetate (PubChem CID 10346026) has the molecular formula C29H44O7 and a molecular weight of 504.66 g/mol. Its IUPAC name is [(1S,3R,5R,6aS,7S,8S,9S)-1-acetyloxy-9-butoxy-5-methoxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] acetate.
| Compound Name | [(1S,3R,5R,6aS,7S,8S,9S)-1-acetyloxy-9-butoxy-5-methoxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] acetate |
|---|---|
| PubChem CID | 10346026 |
| Molecular Formula | C29H44O7 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [(1S,3R,5R,6aS,7S,8S,9S)-1-acetyloxy-9-butoxy-5-methoxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] acetate |
| SMILES | C=C/C(C)=C\C[C@]1(C)[C@H](C)[C@@H](OCCCC)CC23C(=C[C@H](OC)C[C@H]21)[C@@H](OC(C)=O)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C29H44O7/c1-9-11-14-33-24-17-29-23(26(34-20(5)30)36-27(29)35-21(6)31)15-22(32-8)16-25(29)28(7,19(24)4)13-12-18(3)10-2/h10,12,15,19,22,24-27H,2,9,11,13-14,16-17H2,1,3-8H3/b18-12-/t19-,22+,24+,25+,26+,27-,28-,29?/m1/s1 |
| InChIKey | QKMAUFVQQWQVIL-PUKFAUCTSA-N |
| XLogP | 5.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|