About N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide
N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide (PubChem CID 10346069) has the molecular formula C31H43N3OS
and a molecular weight of 505.77 g/mol. Its IUPAC name is N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide.
Molecular Properties
| Compound Name | N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide |
| PubChem CID | 10346069 |
| Molecular Formula | C31H43N3OS |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)CCC |
| InChI | InChI=1S/C31H43N3OS/c1-3-5-6-7-15-23-34(28(35)18-4-2)24-16-10-17-25-36-31-32-29(26-19-11-8-12-20-26)30(33-31)27-21-13-9-14-22-27/h8-9,11-14,19-22H,3-7,10,15-18,23-25H2,1-2H3,(H,32,33) |
| InChIKey | CXIAKTYMZTZLGT-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide?
The IUPAC name of N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide (CID 10346069) is N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide.
What is the SMILES notation for N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide?
The canonical SMILES for N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide is CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)CCC.
What is the InChIKey of N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide?
The InChIKey is CXIAKTYMZTZLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H43N3OS/c1-3-5-6-7-15-23-34(28(35)18-4-2)24-16-10-17-25-36-31-32-29(26-19-11-8-12-20-26)30(33-31)27-21-13-9-14-22-27/h8-9,11-14,19-22H,3-7,10,15-18,23-25H2,1-2H3,(H,32,33).
What are the key properties of N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide?
N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide has a molecular weight of 505.77 g/mol, XLogP of 8.61, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylbutanamide is sourced from PubChem (CID 10346069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).