C17H29NO — CID 103460837
2,2-dimethyl-N-[1-(4-propoxyphenyl)ethyl]butan-1-amine (PubChem CID 103460837) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-[1-(4-propoxyphenyl)ethyl]butan-1-amine.
| Compound Name | 2,2-dimethyl-N-[1-(4-propoxyphenyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 103460837 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,2-dimethyl-N-[1-(4-propoxyphenyl)ethyl]butan-1-amine |
| SMILES | CCCOc1ccc(C(C)NCC(C)(C)CC)cc1 |
| InChI | InChI=1S/C17H29NO/c1-6-12-19-16-10-8-15(9-11-16)14(3)18-13-17(4,5)7-2/h8-11,14,18H,6-7,12-13H2,1-5H3 |
| InChIKey | YWUYVWIREYEROT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |