About 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide
2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide (PubChem CID 103460984) has the molecular formula C10H20BrNO
and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide |
| PubChem CID | 103460984 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide |
| SMILES | CCC(C)(C)CNC(=O)C(C)(C)Br |
| InChI | InChI=1S/C10H20BrNO/c1-6-9(2,3)7-12-8(13)10(4,5)11/h6-7H2,1-5H3,(H,12,13) |
| InChIKey | PNRDZQLHICNLFH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide?
The IUPAC name of 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide (CID 103460984) is 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide.
What is the SMILES notation for 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide?
The canonical SMILES for 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide is CCC(C)(C)CNC(=O)C(C)(C)Br.
What is the InChIKey of 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide?
The InChIKey is PNRDZQLHICNLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO/c1-6-9(2,3)7-12-8(13)10(4,5)11/h6-7H2,1-5H3,(H,12,13).
What are the key properties of 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide?
2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide has a molecular weight of 250.18 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(2,2-dimethylbutyl)-2-methylpropanamide is sourced from PubChem (CID 103460984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).