About 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione
5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione (PubChem CID 10346150) has the molecular formula C22H24Br2N2O2
and a molecular weight of 508.25 g/mol. Its IUPAC name is 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione |
| PubChem CID | 10346150 |
| Molecular Formula | C22H24Br2N2O2 |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione |
| SMILES | CCCCCCCN1C(=O)NC(c2ccc(Br)cc2)(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C22H24Br2N2O2/c1-2-3-4-5-6-15-26-20(27)22(25-21(26)28,16-7-11-18(23)12-8-16)17-9-13-19(24)14-10-17/h7-14H,2-6,15H2,1H3,(H,25,28) |
| InChIKey | DARDHNGWORIPGS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione?
The IUPAC name of 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione (CID 10346150) is 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione.
What is the SMILES notation for 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione?
The canonical SMILES for 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione is CCCCCCCN1C(=O)NC(c2ccc(Br)cc2)(c2ccc(Br)cc2)C1=O.
What is the InChIKey of 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione?
The InChIKey is DARDHNGWORIPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Br2N2O2/c1-2-3-4-5-6-15-26-20(27)22(25-21(26)28,16-7-11-18(23)12-8-16)17-9-13-19(24)14-10-17/h7-14H,2-6,15H2,1H3,(H,25,28).
What are the key properties of 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione?
5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione has a molecular weight of 508.25 g/mol, XLogP of 5.98, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(4-bromophenyl)-3-heptylimidazolidine-2,4-dione is sourced from PubChem (CID 10346150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).