C26H46O2Sn — CID 10346202
(4aR,6E,6aR,10aS)-4a-hydroxy-6-(tributylstannylmethylidene)-2,3,4,5,6a,7,9,10-octahydro-1H-benzo[i]inden-8-one (PubChem CID 10346202) has the molecular formula C26H46O2Sn and a molecular weight of 509.36 g/mol. Its IUPAC name is (4aR,6E,6aR,10aS)-4a-hydroxy-6-(tributylstannylmethylidene)-2,3,4,5,6a,7,9,10-octahydro-1H-benzo[i]inden-8-one.
| Compound Name | (4aR,6E,6aR,10aS)-4a-hydroxy-6-(tributylstannylmethylidene)-2,3,4,5,6a,7,9,10-octahydro-1H-benzo[i]inden-8-one |
|---|---|
| PubChem CID | 10346202 |
| Molecular Formula | C26H46O2Sn |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (4aR,6E,6aR,10aS)-4a-hydroxy-6-(tributylstannylmethylidene)-2,3,4,5,6a,7,9,10-octahydro-1H-benzo[i]inden-8-one |
| SMILES | CCCC[Sn](/C=C1\C[C@]2(O)CCCC[C@@]23CCC(=O)C[C@@H]13)(CCCC)CCCC |
| InChI | InChI=1S/C14H19O2.3C4H9.Sn/c1-10-9-14(16)6-3-2-5-13(14)7-4-11(15)8-12(10)13;3*1-3-4-2;/h1,12,16H,2-9H2;3*1,3-4H2,2H3;/t12-,13-,14+;;;;/m0..../s1 |
| InChIKey | KGBDWVBQAMDRHH-QVBBUCMOSA-N |
| XLogP | 7.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |