About 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one
2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one (PubChem CID 103462488) has the molecular formula C14H24ClN3O
and a molecular weight of 285.82 g/mol. Its IUPAC name is 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one |
| PubChem CID | 103462488 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one |
| SMILES | CCCCn1ncc(NCC(C)(C)CC)c(Cl)c1=O |
| InChI | InChI=1S/C14H24ClN3O/c1-5-7-8-18-13(19)12(15)11(9-17-18)16-10-14(3,4)6-2/h9,16H,5-8,10H2,1-4H3 |
| InChIKey | VGCORUNOPIVCFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one?
The IUPAC name of 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one (CID 103462488) is 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one.
What is the SMILES notation for 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one?
The canonical SMILES for 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one is CCCCn1ncc(NCC(C)(C)CC)c(Cl)c1=O.
What is the InChIKey of 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one?
The InChIKey is VGCORUNOPIVCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24ClN3O/c1-5-7-8-18-13(19)12(15)11(9-17-18)16-10-14(3,4)6-2/h9,16H,5-8,10H2,1-4H3.
What are the key properties of 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one?
2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one has a molecular weight of 285.82 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-chloro-5-(2,2-dimethylbutylamino)pyridazin-3-one is sourced from PubChem (CID 103462488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).