C16H24N2OS — CID 103462820
3-(2,2-dimethylbutyl)-7-propoxy-1H-benzimidazole-2-thione (PubChem CID 103462820) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-(2,2-dimethylbutyl)-7-propoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,2-dimethylbutyl)-7-propoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103462820 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-(2,2-dimethylbutyl)-7-propoxy-1H-benzimidazole-2-thione |
| SMILES | CCCOc1cccc2c1[nH]c(=S)n2CC(C)(C)CC |
| InChI | InChI=1S/C16H24N2OS/c1-5-10-19-13-9-7-8-12-14(13)17-15(20)18(12)11-16(3,4)6-2/h7-9H,5-6,10-11H2,1-4H3,(H,17,20) |
| InChIKey | BWBJFQDECGSUPK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|