C13H18FN3 — CID 103462884
1-(2,2-dimethylbutyl)-6-fluorobenzimidazol-2-amine (PubChem CID 103462884) has the molecular formula C13H18FN3 and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-(2,2-dimethylbutyl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 1-(2,2-dimethylbutyl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 103462884 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-(2,2-dimethylbutyl)-6-fluorobenzimidazol-2-amine |
| SMILES | CCC(C)(C)Cn1c(N)nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H18FN3/c1-4-13(2,3)8-17-11-7-9(14)5-6-10(11)16-12(17)15/h5-7H,4,8H2,1-3H3,(H2,15,16) |
| InChIKey | GHMZCEMEQHDDEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |