C28H26N4O2S2 — CID 10346407
1-phenyl-3-[2-[2-[2-(phenylcarbamothioylamino)phenoxy]ethoxy]phenyl]thiourea (PubChem CID 10346407) has the molecular formula C28H26N4O2S2 and a molecular weight of 514.68 g/mol. Its IUPAC name is 1-phenyl-3-[2-[2-[2-(phenylcarbamothioylamino)phenoxy]ethoxy]phenyl]thiourea.
| Compound Name | 1-phenyl-3-[2-[2-[2-(phenylcarbamothioylamino)phenoxy]ethoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 10346407 |
| Molecular Formula | C28H26N4O2S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1-phenyl-3-[2-[2-[2-(phenylcarbamothioylamino)phenoxy]ethoxy]phenyl]thiourea |
| SMILES | S=C(Nc1ccccc1)Nc1ccccc1OCCOc1ccccc1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C28H26N4O2S2/c35-27(29-21-11-3-1-4-12-21)31-23-15-7-9-17-25(23)33-19-20-34-26-18-10-8-16-24(26)32-28(36)30-22-13-5-2-6-14-22/h1-18H,19-20H2,(H2,29,31,35)(H2,30,32,36) |
| InChIKey | HBHGJUGHRXXAHZ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|