C20H17F3O3 — CID 1034646
9-[2-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 1034646) has the molecular formula C20H17F3O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 9-[2-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[2-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1034646 |
| Molecular Formula | C20H17F3O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 9-[2-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1C(F)(F)F)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C20H17F3O3/c21-20(22,23)12-6-2-1-5-11(12)17-18-13(24)7-3-9-15(18)26-16-10-4-8-14(25)19(16)17/h1-2,5-6,17H,3-4,7-10H2 |
| InChIKey | NGIRNPOURYWPSV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |