C14H30N2 — CID 103465193
1-(2,2-dimethylbutyl)-3,3-diethylpiperazine (PubChem CID 103465193) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-(2,2-dimethylbutyl)-3,3-diethylpiperazine.
| Compound Name | 1-(2,2-dimethylbutyl)-3,3-diethylpiperazine |
|---|---|
| PubChem CID | 103465193 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-(2,2-dimethylbutyl)-3,3-diethylpiperazine |
| SMILES | CCC(C)(C)CN1CCNC(CC)(CC)C1 |
| InChI | InChI=1S/C14H30N2/c1-6-13(4,5)11-16-10-9-15-14(7-2,8-3)12-16/h15H,6-12H2,1-5H3 |
| InChIKey | BZNJZBQYTRUJPR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |