C16H17F13O4 — CID 10346579
diethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pentanedioate (PubChem CID 10346579) has the molecular formula C16H17F13O4 and a molecular weight of 520.28 g/mol. Its IUPAC name is diethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pentanedioate.
| Compound Name | diethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pentanedioate |
|---|---|
| PubChem CID | 10346579 |
| Molecular Formula | C16H17F13O4 |
| Molecular Weight | 520.28 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | diethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pentanedioate |
| SMILES | CCOC(=O)CCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C16H17F13O4/c1-3-32-9(30)6-5-8(10(31)33-4-2)7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h8H,3-7H2,1-2H3 |
| InChIKey | ZIEZTFSPJGWFSK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|