C23H25NO11S — CID 10346692
dimethyl (4aS,5S,8S,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-2,6-dioxo-1,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a,8-dicarboxylate (PubChem CID 10346692) has the molecular formula C23H25NO11S and a molecular weight of 523.52 g/mol. Its IUPAC name is dimethyl (4aS,5S,8S,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-2,6-dioxo-1,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a,8-dicarboxylate.
| Compound Name | dimethyl (4aS,5S,8S,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-2,6-dioxo-1,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a,8-dicarboxylate |
|---|---|
| PubChem CID | 10346692 |
| Molecular Formula | C23H25NO11S |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | dimethyl (4aS,5S,8S,13bR)-11,12-dimethoxy-5-methylsulfonyloxy-2,6-dioxo-1,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(OC)c(OC)cc2[C@]23CC(=O)C=C[C@@]2(C(=O)OC)[C@H](OS(C)(=O)=O)C(=O)N13 |
| InChI | InChI=1S/C23H25NO11S/c1-31-16-9-12-8-15(20(27)33-3)24-19(26)18(35-36(5,29)30)22(21(28)34-4)7-6-13(25)11-23(22,24)14(12)10-17(16)32-2/h6-7,9-10,15,18H,8,11H2,1-5H3/t15-,18+,22-,23+/m0/s1 |
| InChIKey | DVMJNHOSLIZEJB-SXGOCTTJSA-N |
| XLogP | -0.13 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|