C17H14F3N3O4S — CID 10346810
(5S)-5-methyl-1-(pyridin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidine-2,4-dione (PubChem CID 10346810) has the molecular formula C17H14F3N3O4S and a molecular weight of 413.38 g/mol. Its IUPAC name is (5S)-5-methyl-1-(pyridin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-1-(pyridin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10346810 |
| Molecular Formula | C17H14F3N3O4S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (5S)-5-methyl-1-(pyridin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@H]1C(=O)N(c2ccc(S(=O)(=O)C(F)(F)F)cc2)C(=O)N1Cc1ccncc1 |
| InChI | InChI=1S/C17H14F3N3O4S/c1-11-15(24)23(16(25)22(11)10-12-6-8-21-9-7-12)13-2-4-14(5-3-13)28(26,27)17(18,19)20/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | QECCYZYZCPNCFE-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|