C14H11F3N4 — CID 103468304
3-amino-6-[[2-(trifluoromethyl)phenyl]methylamino]pyridine-2-carbonitrile (PubChem CID 103468304) has the molecular formula C14H11F3N4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-amino-6-[[2-(trifluoromethyl)phenyl]methylamino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[[2-(trifluoromethyl)phenyl]methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468304 |
| Molecular Formula | C14H11F3N4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-amino-6-[[2-(trifluoromethyl)phenyl]methylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2ccccc2C(F)(F)F)ccc1N |
| InChI | InChI=1S/C14H11F3N4/c15-14(16,17)10-4-2-1-3-9(10)8-20-13-6-5-11(19)12(7-18)21-13/h1-6H,8,19H2,(H,20,21) |
| InChIKey | QDMYMISRAAEPDL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |