C15H21N5 — CID 103468387
3-amino-6-(3-piperidin-1-ylpyrrolidin-1-yl)pyridine-2-carbonitrile (PubChem CID 103468387) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-amino-6-(3-piperidin-1-ylpyrrolidin-1-yl)pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-(3-piperidin-1-ylpyrrolidin-1-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468387 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-amino-6-(3-piperidin-1-ylpyrrolidin-1-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(N2CCC(N3CCCCC3)C2)ccc1N |
| InChI | InChI=1S/C15H21N5/c16-10-14-13(17)4-5-15(18-14)20-9-6-12(11-20)19-7-2-1-3-8-19/h4-5,12H,1-3,6-9,11,17H2 |
| InChIKey | KETUOQPFTUCXPL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |