C12H16N4O — CID 103468909
3-amino-6-[methyl-(2-methyloxolan-3-yl)amino]pyridine-2-carbonitrile (PubChem CID 103468909) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-amino-6-[methyl-(2-methyloxolan-3-yl)amino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[methyl-(2-methyloxolan-3-yl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468909 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-amino-6-[methyl-(2-methyloxolan-3-yl)amino]pyridine-2-carbonitrile |
| SMILES | CC1OCCC1N(C)c1ccc(N)c(C#N)n1 |
| InChI | InChI=1S/C12H16N4O/c1-8-11(5-6-17-8)16(2)12-4-3-9(14)10(7-13)15-12/h3-4,8,11H,5-6,14H2,1-2H3 |
| InChIKey | PRIWZTPJMWSAEB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |