C11H13N5O3 — CID 103471269
2-[(6-cyano-5-nitro-2-pyridinyl)amino]-N-propylacetamide (PubChem CID 103471269) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[(6-cyano-5-nitro-2-pyridinyl)amino]-N-propylacetamide.
| Compound Name | 2-[(6-cyano-5-nitro-2-pyridinyl)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 103471269 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(6-cyano-5-nitro-2-pyridinyl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1ccc([N+](=O)[O-])c(C#N)n1 |
| InChI | InChI=1S/C11H13N5O3/c1-2-5-13-11(17)7-14-10-4-3-9(16(18)19)8(6-12)15-10/h3-4H,2,5,7H2,1H3,(H,13,17)(H,14,15) |
| InChIKey | FYGSMIWUMYWMOL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|