C12H13N5O3 — CID 103472451
6-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)amino]-3-nitropyridine-2-carbonitrile (PubChem CID 103472451) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 6-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)amino]-3-nitropyridine-2-carbonitrile.
| Compound Name | 6-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)amino]-3-nitropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103472451 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 6-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)amino]-3-nitropyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NC2C(N)C3CCOC32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O3/c13-5-7-8(17(18)19)1-2-9(15-7)16-11-10(14)6-3-4-20-12(6)11/h1-2,6,10-12H,3-4,14H2,(H,15,16) |
| InChIKey | FHWHJCCIKHWRLO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|