C13H15N5O2 — CID 103472601
6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-3-nitropyridine-2-carbonitrile (PubChem CID 103472601) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-3-nitropyridine-2-carbonitrile.
| Compound Name | 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-3-nitropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103472601 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-3-nitropyridine-2-carbonitrile |
| SMILES | N#Cc1nc(N2CCC3CCC(C2)N3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N5O2/c14-7-11-12(18(19)20)3-4-13(16-11)17-6-5-9-1-2-10(8-17)15-9/h3-4,9-10,15H,1-2,5-6,8H2 |
| InChIKey | AXQSKXDSXSWWCY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|