C8H11F4N3O2 — CID 103472894
2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 103472894) has the molecular formula C8H11F4N3O2 and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | 2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103472894 |
| Molecular Formula | C8H11F4N3O2 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | NCCc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C8H11F4N3O2/c9-7(10)8(11,12)4-16-3-5-14-6(1-2-13)17-15-5/h7H,1-4,13H2 |
| InChIKey | CFJVBLBPROSRLM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|