C10H15F4N3O2 — CID 103472978
N-ethyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 103472978) has the molecular formula C10H15F4N3O2 and a molecular weight of 285.24 g/mol. Its IUPAC name is N-ethyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | N-ethyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103472978 |
| Molecular Formula | C10H15F4N3O2 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-ethyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | CCNCCc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C10H15F4N3O2/c1-2-15-4-3-8-16-7(17-19-8)5-18-6-10(13,14)9(11)12/h9,15H,2-6H2,1H3 |
| InChIKey | LQZOZUGLDJFORG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|