C8H7F4N5O3 — CID 103472979
4-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 103472979) has the molecular formula C8H7F4N5O3 and a molecular weight of 297.17 g/mol. Its IUPAC name is 4-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 103472979 |
| Molecular Formula | C8H7F4N5O3 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C8H7F4N5O3/c9-7(10)8(11,12)2-18-1-3-14-6(19-15-3)4-5(13)17-20-16-4/h7H,1-2H2,(H2,13,17) |
| InChIKey | DXXNYKNRWBZRLW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|