C12H17F4N3O2 — CID 103473002
2-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine (PubChem CID 103473002) has the molecular formula C12H17F4N3O2 and a molecular weight of 311.28 g/mol. Its IUPAC name is 2-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine.
| Compound Name | 2-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103473002 |
| Molecular Formula | C12H17F4N3O2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
| SMILES | CC1(c2nc(COCC(F)(F)C(F)F)no2)CCCC1N |
| InChI | InChI=1S/C12H17F4N3O2/c1-11(4-2-3-7(11)17)10-18-8(19-21-10)5-20-6-12(15,16)9(13)14/h7,9H,2-6,17H2,1H3 |
| InChIKey | DPCOZHWLBVDABJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|