C9H13F4N3O2 — CID 103473082
N-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 103473082) has the molecular formula C9H13F4N3O2 and a molecular weight of 271.21 g/mol. Its IUPAC name is N-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | N-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103473082 |
| Molecular Formula | C9H13F4N3O2 |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-methyl-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | CNCCc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C9H13F4N3O2/c1-14-3-2-7-15-6(16-18-7)4-17-5-9(12,13)8(10)11/h8,14H,2-5H2,1H3 |
| InChIKey | WEJFKJHZZSKEND-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|