C8H8F4N6O2 — CID 103473085
5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 103473085) has the molecular formula C8H8F4N6O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103473085 |
| Molecular Formula | C8H8F4N6O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2nc(COCC(F)(F)C(F)F)no2)n1 |
| InChI | InChI=1S/C8H8F4N6O2/c9-6(10)8(11,12)2-19-1-3-14-5(20-18-3)4-15-7(13)17-16-4/h6H,1-2H2,(H3,13,15,16,17) |
| InChIKey | ZPAOIUUWHVBNSZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|