C11H15F4N3O2 — CID 103473134
N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclopropanamine (PubChem CID 103473134) has the molecular formula C11H15F4N3O2 and a molecular weight of 297.25 g/mol. Its IUPAC name is N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclopropanamine.
| Compound Name | N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 103473134 |
| Molecular Formula | C11H15F4N3O2 |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclopropanamine |
| SMILES | FC(F)C(F)(F)COCc1noc(CCNC2CC2)n1 |
| InChI | InChI=1S/C11H15F4N3O2/c12-10(13)11(14,15)6-19-5-8-17-9(20-18-8)3-4-16-7-1-2-7/h7,10,16H,1-6H2 |
| InChIKey | HQNMSBVEPREAFW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|