C12H15F4NO3S — CID 103473430
4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 103473430) has the molecular formula C12H15F4NO3S and a molecular weight of 329.32 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103473430 |
| Molecular Formula | C12H15F4NO3S |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)(C)c1nc(COCC(F)(F)C(F)F)sc1C(=O)O |
| InChI | InChI=1S/C12H15F4NO3S/c1-11(2,3)8-7(9(18)19)21-6(17-8)4-20-5-12(15,16)10(13)14/h10H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | FAIPGCOQTIUHNG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|