C12H15ClF4N2O — CID 103473526
4-tert-butyl-6-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473526) has the molecular formula C12H15ClF4N2O and a molecular weight of 314.71 g/mol. Its IUPAC name is 4-tert-butyl-6-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-tert-butyl-6-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473526 |
| Molecular Formula | C12H15ClF4N2O |
| Molecular Weight | 314.71 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-tert-butyl-6-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | CC(C)(C)c1cc(Cl)nc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C12H15ClF4N2O/c1-11(2,3)7-4-8(13)19-9(18-7)5-20-6-12(16,17)10(14)15/h4,10H,5-6H2,1-3H3 |
| InChIKey | YXTANPUJGVXPOK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|