C13H15ClF4N2O — CID 103473544
4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine (PubChem CID 103473544) has the molecular formula C13H15ClF4N2O and a molecular weight of 326.72 g/mol. Its IUPAC name is 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine.
| Compound Name | 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
|---|---|
| PubChem CID | 103473544 |
| Molecular Formula | C13H15ClF4N2O |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
| SMILES | FC(F)C(F)(F)COCc1nc(Cl)c2c(n1)CCCCC2 |
| InChI | InChI=1S/C13H15ClF4N2O/c14-11-8-4-2-1-3-5-9(8)19-10(20-11)6-21-7-13(17,18)12(15)16/h12H,1-7H2 |
| InChIKey | ZIJXOWTXTFTRGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|