C11H13ClF4N2O — CID 103473547
4-chloro-6-ethyl-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473547) has the molecular formula C11H13ClF4N2O and a molecular weight of 300.68 g/mol. Its IUPAC name is 4-chloro-6-ethyl-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-chloro-6-ethyl-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473547 |
| Molecular Formula | C11H13ClF4N2O |
| Molecular Weight | 300.68 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-chloro-6-ethyl-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | CCc1nc(COCC(F)(F)C(F)F)nc(Cl)c1C |
| InChI | InChI=1S/C11H13ClF4N2O/c1-3-7-6(2)9(12)18-8(17-7)4-19-5-11(15,16)10(13)14/h10H,3-5H2,1-2H3 |
| InChIKey | DRSFCGXDAAOLFU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|