C25H24N2O12 — CID 10347357
3,5-bis[2-[(3,4,5-trihydroxybenzoyl)amino]ethoxy]benzoic acid (PubChem CID 10347357) has the molecular formula C25H24N2O12 and a molecular weight of 544.47 g/mol. Its IUPAC name is 3,5-bis[2-[(3,4,5-trihydroxybenzoyl)amino]ethoxy]benzoic acid.
| Compound Name | 3,5-bis[2-[(3,4,5-trihydroxybenzoyl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10347357 |
| Molecular Formula | C25H24N2O12 |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 3,5-bis[2-[(3,4,5-trihydroxybenzoyl)amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cc(OCCNC(=O)c2cc(O)c(O)c(O)c2)cc(OCCNC(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C25H24N2O12/c28-17-7-12(8-18(29)21(17)32)23(34)26-1-3-38-15-5-14(25(36)37)6-16(11-15)39-4-2-27-24(35)13-9-19(30)22(33)20(31)10-13/h5-11,28-33H,1-4H2,(H,26,34)(H,27,35)(H,36,37) |
| InChIKey | QYRSXDBAZBVUAL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 235.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|