C11H12BrClF4N2O — CID 103473580
5-bromo-4-chloro-6-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473580) has the molecular formula C11H12BrClF4N2O and a molecular weight of 379.58 g/mol. Its IUPAC name is 5-bromo-4-chloro-6-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 5-bromo-4-chloro-6-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473580 |
| Molecular Formula | C11H12BrClF4N2O |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 5-bromo-4-chloro-6-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | CC(C)c1nc(COCC(F)(F)C(F)F)nc(Cl)c1Br |
| InChI | InChI=1S/C11H12BrClF4N2O/c1-5(2)8-7(12)9(13)19-6(18-8)3-20-4-11(16,17)10(14)15/h5,10H,3-4H2,1-2H3 |
| InChIKey | HELJEYUPINNTAA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|