C10H10BrClF4N2O2 — CID 103473583
5-bromo-4-chloro-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473583) has the molecular formula C10H10BrClF4N2O2 and a molecular weight of 381.55 g/mol. Its IUPAC name is 5-bromo-4-chloro-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 5-bromo-4-chloro-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473583 |
| Molecular Formula | C10H10BrClF4N2O2 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 5-bromo-4-chloro-6-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | COCc1nc(COCC(F)(F)C(F)F)nc(Cl)c1Br |
| InChI | InChI=1S/C10H10BrClF4N2O2/c1-19-2-5-7(11)8(12)18-6(17-5)3-20-4-10(15,16)9(13)14/h9H,2-4H2,1H3 |
| InChIKey | VUGCKBZTQROYMY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|