C12H16F4N2O2 — CID 103473628
1-(2-ethyl-5-methylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473628) has the molecular formula C12H16F4N2O2 and a molecular weight of 296.26 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473628 |
| Molecular Formula | C12H16F4N2O2 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | CCn1nc(C)cc1CC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H16F4N2O2/c1-3-18-9(4-8(2)17-18)5-10(19)6-20-7-12(15,16)11(13)14/h4,11H,3,5-7H2,1-2H3 |
| InChIKey | GXUPHYFQAHLUPI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|