C11H14F4N2O2 — CID 103473678
1-(2,5-dimethylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473678) has the molecular formula C11H14F4N2O2 and a molecular weight of 282.24 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473678 |
| Molecular Formula | C11H14F4N2O2 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | Cc1cc(CC(=O)COCC(F)(F)C(F)F)n(C)n1 |
| InChI | InChI=1S/C11H14F4N2O2/c1-7-3-8(17(2)16-7)4-9(18)5-19-6-11(14,15)10(12)13/h3,10H,4-6H2,1-2H3 |
| InChIKey | IBTZTDJRCMGKEB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|