C11H16F4O3 — CID 103473710
1-(oxan-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473710) has the molecular formula C11H16F4O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(oxan-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473710 |
| Molecular Formula | C11H16F4O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(oxan-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)C(F)F)CC1CCOCC1 |
| InChI | InChI=1S/C11H16F4O3/c12-10(13)11(14,15)7-18-6-9(16)5-8-1-3-17-4-2-8/h8,10H,1-7H2 |
| InChIKey | QZKLBGDURCCFIB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|