C13H18F4N2O2 — CID 103473878
1-(1-butan-2-ylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473878) has the molecular formula C13H18F4N2O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473878 |
| Molecular Formula | C13H18F4N2O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | CCC(C)n1ccc(CC(=O)COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C13H18F4N2O2/c1-3-9(2)19-5-4-10(18-19)6-11(20)7-21-8-13(16,17)12(14)15/h4-5,9,12H,3,6-8H2,1-2H3 |
| InChIKey | BKSHZDHJCFTSRV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|