C11H16F4N2O2 — CID 103474088
4-(2-methylpyrazol-3-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-ol (PubChem CID 103474088) has the molecular formula C11H16F4N2O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 4-(2-methylpyrazol-3-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-ol.
| Compound Name | 4-(2-methylpyrazol-3-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-ol |
|---|---|
| PubChem CID | 103474088 |
| Molecular Formula | C11H16F4N2O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(2-methylpyrazol-3-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-ol |
| SMILES | Cn1nccc1CCC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H16F4N2O2/c1-17-8(4-5-16-17)2-3-9(18)6-19-7-11(14,15)10(12)13/h4-5,9-10,18H,2-3,6-7H2,1H3 |
| InChIKey | QTVFBNAZBXMELI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|