C13H23F4NO2 — CID 103474705
2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine (PubChem CID 103474705) has the molecular formula C13H23F4NO2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 103474705 |
| Molecular Formula | C13H23F4NO2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
| SMILES | CC1(C)CC(C(N)COCC(F)(F)C(F)F)C(C)(C)O1 |
| InChI | InChI=1S/C13H23F4NO2/c1-11(2)5-8(12(3,4)20-11)9(18)6-19-7-13(16,17)10(14)15/h8-10H,5-7,18H2,1-4H3 |
| InChIKey | PJSKAHMPVSNOPC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|