C11H19F4NO2 — CID 103474748
4-(oxolan-2-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine (PubChem CID 103474748) has the molecular formula C11H19F4NO2 and a molecular weight of 273.27 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine.
| Compound Name | 4-(oxolan-2-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine |
|---|---|
| PubChem CID | 103474748 |
| Molecular Formula | C11H19F4NO2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-(oxolan-2-yl)-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine |
| SMILES | NC(CCC1CCCO1)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H19F4NO2/c12-10(13)11(14,15)7-17-6-8(16)3-4-9-2-1-5-18-9/h8-10H,1-7,16H2 |
| InChIKey | FSBUIIXGHBTJGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|